EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37N3O9 |
| Net Charge | 0 |
| Average Mass | 463.528 |
| Monoisotopic Mass | 463.25298 |
| SMILES | [H]C(=O)N[C@H]1[C@H](O)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@H](OCCCCCN)O[C@@H]1C |
| InChI | InChI=1S/C20H37N3O9/c1-10-13(22-9-24)17(28)18(20(30-10)29-8-6-4-5-7-21)32-19-14(23-12(3)25)16(27)15(26)11(2)31-19/h9-11,13-20,26-28H,4-8,21H2,1-3H3,(H,22,24)(H,23,25)/t10-,11-,13-,14-,15-,16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | ATDMTVWUXIINBV-CRDUVDPNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-aminopentyl 2-O-(2-acetamido-2,6-dideoxy-β-D-Glcp)-4,6-dideoxy-4-formamido-β-D-Glcp (CHEBI:233532) has role epitope (CHEBI:53000) |
| 5-aminopentyl 2-O-(2-acetamido-2,6-dideoxy-β-D-Glcp)-4,6-dideoxy-4-formamido-β-D-Glcp (CHEBI:233532) is a N-formylderivative (CHEBI:7282) |
| 5-aminopentyl 2-O-(2-acetamido-2,6-dideoxy-β-D-Glcp)-4,6-dideoxy-4-formamido-β-D-Glcp (CHEBI:233532) is a acetamides (CHEBI:22160) |
| 5-aminopentyl 2-O-(2-acetamido-2,6-dideoxy-β-D-Glcp)-4,6-dideoxy-4-formamido-β-D-Glcp (CHEBI:233532) is a amino disaccharide (CHEBI:22480) |
| 5-aminopentyl 2-O-(2-acetamido-2,6-dideoxy-β-D-Glcp)-4,6-dideoxy-4-formamido-β-D-Glcp (CHEBI:233532) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 5-aminopentyl 2-O-(2-acetamido-2,6-dideoxy-β-D-glucopyranosyl)-4,6-dideoxy-4-formamido-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 5-amino-pentanyl 2-acetamido-2,6-dideoxy-α-D-glucopyranosyl-(1→2)-4-N-formamido-4,6-dideoxy-β-D-glucopyranoside | ChEBI |
| Citations |
|---|