EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O7S |
| Net Charge | 0 |
| Average Mass | 472.644 |
| Monoisotopic Mass | 472.24947 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](OS(=O)(=O)O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)O)[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C24H40O7S/c1-14(4-9-22(26)27)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(24(18,19)3)31-32(28,29)30/h14-21,25H,4-13H2,1-3H3,(H,26,27)(H,28,29,30)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1 |
| InChIKey | GMRIQHBJNVMHJA-LLQZFEROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxycholic acid 12-sulfate (CHEBI:233494) is a bile acid (CHEBI:3098) |
| deoxycholic acid 12-sulfate (CHEBI:233494) is a steroid sulfate (CHEBI:16158) |