EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N3O12 |
| Net Charge | 0 |
| Average Mass | 479.439 |
| Monoisotopic Mass | 479.17512 |
| SMILES | CC(=O)N[C@@H]1[C@H](NC(C)=O)[C@@H](O)O[C@H](C(=O)O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C18H29N3O12/c1-5(23)19-9-10(20-6(2)24)17(30)32-15(16(28)29)14(9)33-18-11(21-7(3)25)13(27)12(26)8(4-22)31-18/h8-15,17-18,22,26-27,30H,4H2,1-3H3,(H,19,23)(H,20,24)(H,21,25)(H,28,29)/t8-,9-,10+,11-,12-,13-,14+,15+,17+,18-/m1/s1 |
| InChIKey | SYFNPAZEQTWJIN-SWZWMBEUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-GlcNAcp-(1→4)-α-D-(2,3-diNAc)ManAp (CHEBI:233483) has role epitope (CHEBI:53000) |
| α-D-GlcNAcp-(1→4)-α-D-(2,3-diNAc)ManAp (CHEBI:233483) is a acetamides (CHEBI:22160) |
| α-D-GlcNAcp-(1→4)-α-D-(2,3-diNAc)ManAp (CHEBI:233483) is a amino disaccharide (CHEBI:22480) |
| α-D-GlcNAcp-(1→4)-α-D-(2,3-diNAc)ManAp (CHEBI:233483) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2,3-diacetamido-4-O-(2-acetamido-2-deoxy-α-D-glucopyranosyl)-2,3-dideoxy-α-D-mannopyranuronic acid |
| Synonym | Source |
|---|---|
| α-D-GlcNAc-(1→4)-α-D-(2,3-diNAc)ManA | ChEBI |
| Citations |
|---|