EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N8O |
| Net Charge | 0 |
| Average Mass | 454.538 |
| Monoisotopic Mass | 454.22296 |
| SMILES | CCc1cc(C(N)=O)ccc1-n1nc(C(C)C)c2c(-n3cnc(-c4cnn(C)c4)c3)ccnc21 |
| InChI | InChI=1S/C25H26N8O/c1-5-16-10-17(24(26)34)6-7-20(16)33-25-22(23(30-33)15(2)3)21(8-9-27-25)32-13-19(28-14-32)18-11-29-31(4)12-18/h6-15H,5H2,1-4H3,(H2,26,34) |
| InChIKey | NVVPMZUGELHVMH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tas-116 (CHEBI:233475) has role antineoplastic agent (CHEBI:35610) |
| Tas-116 (CHEBI:233475) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 1260533-36-5 | SUBMITTER |
| 3-ethyl-4-[4-[4-(1-methylpyrazol-4-yl)imidazol-1-yl]-3-propan-2-ylpyrazolo[3,4-b]pyridin-1-yl]benzamide | SUBMITTER |
| Jeselhy | SUBMITTER |
| Pimitespib | SUBMITTER |
| Tas 116 | ChEMBL |
| TAS-116 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1260533-36-5 | SUBMITTER |
| Citations |
|---|