EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37NO3 |
| Net Charge | 0 |
| Average Mass | 363.542 |
| Monoisotopic Mass | 363.27734 |
| SMILES | [H][C@](CO)(C[C@]([H])(O)c1ccccc1)/N=C(\O)CCCCCCCCCCC |
| InChI | InChI=1S/C22H37NO3/c1-2-3-4-5-6-7-8-9-13-16-22(26)23-20(18-24)17-21(25)19-14-11-10-12-15-19/h10-12,14-15,20-21,24-25H,2-9,13,16-18H2,1H3,(H,23,26)/t20-,21+/m1/s1 |
| InChIKey | YCAKBKAOFSILDC-RTWAWAEBSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.* (protein-serine/threonine kinase) inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of any protein-serine/threonine kinase (EC 2.7.11.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HPA-12 (CHEBI:233449) has role EC 2.7.11.* (protein-serine/threonine kinase) inhibitor (CHEBI:76812) |
| HPA-12 (CHEBI:233449) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(2R,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]dodecanamide |
| Synonym | Source |
|---|---|
| N-(3-hydroxy-1-hydroxymethyl-3-phenylpropyl)dodecanamide | SUBMITTER |
| Citations |
|---|