EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N |
| Net Charge | 0 |
| Average Mass | 157.216 |
| Monoisotopic Mass | 157.08915 |
| SMILES | Cc1ccc2ccccc2c1N |
| InChI | InChI=1S/C11H11N/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,12H2,1H3 |
| InChIKey | JMBLSGAXSMOKPN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lactobacillus plantarum (ncbitaxon:1590) | - | PubMed (31673827) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylnaphthalen-1-amine (CHEBI:233447) has role bacterial metabolite (CHEBI:76969) |
| 2-methylnaphthalen-1-amine (CHEBI:233447) is a aminonaphthalene (CHEBI:38034) |
| 2-methylnaphthalen-1-amine (CHEBI:233447) is a methylnaphthalenes (CHEBI:25324) |
| 2-methylnaphthalen-1-amine (CHEBI:233447) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 2-methylnaphthalen-1-amine |
| Synonyms | Source |
|---|---|
| 2-methyl-1-naphthylamine | SUBMITTER |
| 1-amino-2-methylnaphthalene | SUBMITTER |
| 2-methyl-1-aminonaphthalene | ChEBI |
| 2-methyl-1-naphthalenamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2042530 | Reaxys |
| CAS:2246-44-8 | SUBMITTER |
| Citations |
|---|