EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11.H2O |
| Net Charge | 0 |
| Average Mass | 360.312 |
| Monoisotopic Mass | 360.12678 |
| SMILES | O.[H][C@]1(O[C@@]([H])([C@]([H])(O)[C@@]([H])(O)C=O)[C@]([H])(O)CO)O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])O |
| InChI | InChI=1S/C12H22O11.H2O/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12;/h1,4-12,14-21H,2-3H2;1H2/t4-,5+,6+,7+,8+,9-,10+,11+,12+;/m0./s1 |
| InChIKey | HBDJFVFTHLOSDW-DNDLZOGFSA-N |
| Roles Classification |
|---|
| Biological Role: | ion transport inhibitor A compound which inhibits the movement of an ion across an energy-transducing cell membrane. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(N-ethyl-N-isopropyl) amiloride (CHEBI:233428) has role ion transport inhibitor (CHEBI:50184) |
| 5-(N-ethyl-N-isopropyl) amiloride (CHEBI:233428) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-amino-6-chloro-5-[ethyl(propan-2-yl)amino]-N-[(Z)-hydrazinylidenemethyl]pyrazine-2-carboxamide |
| Citations |
|---|