EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9FN2O2 |
| Net Charge | 0 |
| Average Mass | 232.214 |
| Monoisotopic Mass | 232.06481 |
| SMILES | O=C1CC(c2cnc3ccc(F)cc23)C(=O)N1 |
| InChI | InChI=1S/C12H9FN2O2/c13-6-1-2-10-7(3-6)9(5-14-10)8-4-11(16)15-12(8)17/h1-3,5,8,14H,4H2,(H,15,16,17) |
| InChIKey | MXKLDYKORJEOPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pf-06840003 (CHEBI:233415) has role antineoplastic agent (CHEBI:35610) |
| Pf-06840003 (CHEBI:233415) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 198474-05-4 | SUBMITTER |
| 3-(5-fluoro-1H-indol-3-yl)pyrrolidine-2,5-dione | SUBMITTER |
| PF-06840003 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:198474-05-4 | SUBMITTER |
| Citations |
|---|