EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29N5O |
| Net Charge | 0 |
| Average Mass | 439.563 |
| Monoisotopic Mass | 439.23721 |
| SMILES | Cc1nnc(-c2cc(C(=O)N3CCC(c4ccc(C#N)cc4)CC3)c(C)cc2C2CCC2)n1 |
| InChI | InChI=1S/C27H29N5O/c1-17-14-24(22-4-3-5-22)25(26-29-18(2)30-31-26)15-23(17)27(33)32-12-10-21(11-13-32)20-8-6-19(16-28)7-9-20/h6-9,14-15,21-22H,3-5,10-13H2,1-2H3,(H,29,30,31) |
| InChIKey | BBGOSBDSLYHMRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Denifanstat (CHEBI:233413) has role antineoplastic agent (CHEBI:35610) |
| Denifanstat (CHEBI:233413) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 1399177-37-7 | SUBMITTER |
| 4-[1-[4-cyclobutyl-2-methyl-5-(5-methyl-1H-1,2,4-triazol-3-yl)benzoyl]piperidin-4-yl]benzonitrile | SUBMITTER |
| ASC-40 | ChEMBL |
| Denifanstat | ChEMBL |
| Tvb 2640 | ChEMBL |
| TVB-2640 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1399177-37-7 | SUBMITTER |