EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45NO |
| Net Charge | 0 |
| Average Mass | 399.663 |
| Monoisotopic Mass | 399.35012 |
| SMILES | [H][C@@]12CCC3=C/C(=N/O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@]([H])(C)CCCC(C)C |
| InChI | InChI=1S/C27H45NO/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28-29)13-15-26(20,4)25(22)14-16-27(23,24)5/h17-19,22-25,29H,6-16H2,1-5H3/b28-21+/t19-,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | QNTASHOAVRSLMD-SIWSWZRQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olesoxime (CHEBI:233408) has role neuroprotective agent (CHEBI:63726) |
| olesoxime (CHEBI:233408) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| Manual Xrefs | Databases |
|---|---|
| D11213 | KEGG DRUG |
| DB05185 | DrugBank |
| https://en.wikipedia.org/wiki/Olesoxime | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:22033-87-0 | SUBMITTER |
| Citations |
|---|