EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | BF4.C12H23N2 |
| Net Charge | 0 |
| Average Mass | 282.134 |
| Monoisotopic Mass | 282.18904 |
| SMILES | CCCCCCCCn1cc[n+](C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C12H23N2.BF4/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;2-1(3,4)5/h10-12H,3-9H2,1-2H3;/q+1;-1 |
| InChIKey | GXZCAMSPWNHTAE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyl-3-octylimidazolium tetrafluoroborate (CHEBI:233407) has role genotoxin (CHEBI:50902) |
| 1-methyl-3-octylimidazolium tetrafluoroborate (CHEBI:233407) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-methyl-3-octylimidazol-1-ium;tetrafluoroborate |
| Citations |
|---|