EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3OS |
| Net Charge | 0 |
| Average Mass | 339.464 |
| Monoisotopic Mass | 339.14053 |
| SMILES | O/C(CN1CCCCC1)=N\N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C19H21N3OS/c23-19(14-21-12-6-1-7-13-21)20-22-15-8-2-4-10-17(15)24-18-11-5-3-9-16(18)22/h2-5,8-11H,1,6-7,12-14H2,(H,20,23) |
| InChIKey | ALVVXSSFOOYRDP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FD44 (CHEBI:233406) has role inhibitor (CHEBI:35222) |
| FD44 (CHEBI:233406) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-phenothiazin-10-yl-2-piperidin-1-ylacetamide |
| Citations |
|---|