EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233405 - fluralaner
| Formula | C22H17Cl2F6N3O3 |
| Net Charge | 0 |
| Average Mass | 556.290 |
| Monoisotopic Mass | 555.05512 |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NC/C(O)=N/CC(F)(F)F |
| InChI | InChI=1S/C22H17Cl2F6N3O3/c1-11-4-12(2-3-16(11)19(35)31-9-18(34)32-10-21(25,26)27)17-8-20(36-33-17,22(28,29)30)13-5-14(23)7-15(24)6-13/h2-7H,8-10H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | MLBZKOGAMRTSKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluralaner (CHEBI:233405) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| fluralaner (CHEBI:233405) has role insecticide (CHEBI:24852) |
| fluralaner (CHEBI:233405) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| DB11414 | DrugBank |
| HMDB0252406 | HMDB |
| D10402 | KEGG DRUG |
| https://en.wikipedia.org/wiki/Fluralaner | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:864731-61-3 | SUBMITTER |
| Citations |
|---|