EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N6O |
| Net Charge | 0 |
| Average Mass | 396.454 |
| Monoisotopic Mass | 396.16986 |
| SMILES | C=CC(=O)N[C@H]1C=C(C)c2c(-c3cnc4ccccc4c3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C23H20N6O/c1-3-18(30)28-16-8-13(2)21-19(15-9-14-6-4-5-7-17(14)25-10-15)20-22(24)26-12-27-23(20)29(21)11-16/h3-10,12,16H,1,11H2,2H3,(H,28,30)(H2,24,26,27)/t16-/m0/s1 |
| InChIKey | MKCYPWYURWOKST-INIZCTEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zipalertinib (CHEBI:233402) has role antineoplastic agent (CHEBI:35610) |
| zipalertinib (CHEBI:233402) has role apoptosis inducer (CHEBI:68495) |
| zipalertinib (CHEBI:233402) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| zipalertinib (CHEBI:233402) is a acrylamides (CHEBI:22216) |
| zipalertinib (CHEBI:233402) is a aromatic amine (CHEBI:33860) |
| zipalertinib (CHEBI:233402) is a organic heterotricyclic compound (CHEBI:26979) |
| zipalertinib (CHEBI:233402) is a primary amino compound (CHEBI:50994) |
| zipalertinib (CHEBI:233402) is a quinolines (CHEBI:26513) |
| zipalertinib (CHEBI:233402) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[(8S)-4-amino-6-methyl-5-(quinolin-3-yl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]prop-2-enamide |
| INNs | Source |
|---|---|
| zipalertinib | WHO MedNet |
| zipalertinibum | WHO MedNet |
| zipalertinib | WHO MedNet |
| zipalertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| TAS-6417 | ChEBI |
| CLN 081 | ChEBI |
| CLN-081 | ChEBI |
| TAS 6417 | ChEBI |
| CLN081 | ChEBI |
| TAS6417 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB18763 | DrugBank |
| Zipalertinib | Wikipedia |
| X9H | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1661854-97-2 | ChEBI |
| Citations |
|---|