EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32F2N8 |
| Net Charge | 0 |
| Average Mass | 506.605 |
| Monoisotopic Mass | 506.27180 |
| SMILES | CCN1CCN(Cc2ccc(Nc3ncc(F)c(-c4cc(F)c5nc(C)n(C(C)C)c5c4)n3)nc2)CC1 |
| InChI | InChI=1S/C27H32F2N8/c1-5-35-8-10-36(11-9-35)16-19-6-7-24(30-14-19)33-27-31-15-22(29)25(34-27)20-12-21(28)26-23(13-20)37(17(2)3)18(4)32-26/h6-7,12-15,17H,5,8-11,16H2,1-4H3,(H,30,31,33,34) |
| InChIKey | UZWDCWONPYILKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Abemaciclib (CHEBI:233362) has role antineoplastic agent (CHEBI:35610) |
| Abemaciclib (CHEBI:233362) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 1231929-97-7 | SUBMITTER |
| Abemaciclib | ChEMBL |
| LY-2835219 | ChEMBL |
| LY2835219 | SUBMITTER |
| N-(5-((4-ethylpiperazin-1-yl)methyl)pyridin-2-yl)-5-fluoro-4-(4-fluoro-1-isopropyl-2-methyl-1H-benzo[d]imidazol-6-yl)pyrimidin-2-amine | SUBMITTER |
| Brand Names | Source |
|---|---|
| Verzenio | ChEMBL |
| Verzenios | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1231929-97-7 | SUBMITTER |
| Citations |
|---|