EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28ClN5O2 |
| Net Charge | 0 |
| Average Mass | 429.952 |
| Monoisotopic Mass | 429.19315 |
| SMILES | CC(=O)N[C@@H]1CCC[C@H](C(=O)Nc2cc(-c3cnn4c3CC(C)(C)C4)c(Cl)cn2)C1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-13(29)26-15-6-4-5-14(7-15)21(30)27-20-8-16(18(23)11-24-20)17-10-25-28-12-22(2,3)9-19(17)28/h8,10-11,14-15H,4-7,9,12H2,1-3H3,(H,26,29)(H,24,27,30)/t14-,15+/m0/s1 |
| InChIKey | AVIWDYSJSPOOAR-LSDHHAIUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD4573 (CHEBI:233359) has role antineoplastic agent (CHEBI:35610) |
| AZD4573 (CHEBI:233359) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| zemirciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1S,3R)-3-acetamido-N-(5-chloro-4-(5,5-dimethyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)pyridin-2-yl)cyclohexane-1-carboxamide | SUBMITTER |
| 2057509-72-3 | SUBMITTER |
| Azd 4573 | ChEMBL |
| AZD-4573 | ChEMBL |
| AZD4573 | ChEMBL |
| zemirciclib | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:2057509-72-3 | SUBMITTER |
| Citations |
|---|