EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233355 - 4-aminobenzohydrazide
| Formula | C7H9N3O |
| Net Charge | 0 |
| Average Mass | 151.169 |
| Monoisotopic Mass | 151.07456 |
| SMILES | NNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C7H9N3O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,8-9H2,(H,10,11) |
| InChIKey | WPBZMCGPFHZRHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.11.2.2 (myeloperoxidase) inhibitor An EC 1.11.2.* (oxidoreductase with H2O2 as acceptor, incorporating 1 O atom into product) inhibitor that interferes with the action of myeloperoxidase (EC 1.11.2.2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminobenzohydrazide (CHEBI:233355) has role EC 1.11.2.2 (myeloperoxidase) inhibitor (CHEBI:79093) |
| 4-aminobenzohydrazide (CHEBI:233355) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 4-aminobenzohydrazide |
| Synonyms | Source |
|---|---|
| 4-Aminobenzoic acid hydrazide | SUBMITTER |
| Aminostimil | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0246354 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:5351-17-7 | SUBMITTER |
| Citations |
|---|