EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO4 |
| Net Charge | 0 |
| Average Mass | 273.288 |
| Monoisotopic Mass | 273.10011 |
| SMILES | [NH3+][C@@H](Cc1ccc(Oc2ccc(O)cc2)cc1)C(=O)[O-] |
| InChI | InChI=1S/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | KKCIOUWDFWQUBT-AWEZNQCLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-thyronine zwitterion (CHEBI:233333) is a amino-acid zwitterion (CHEBI:35238) |
| L-thyronine zwitterion (CHEBI:233333) is tautomer of L-thyronine (CHEBI:30662) |
| Incoming Relation(s) |
| L-thyronine (CHEBI:30662) is tautomer of L-thyronine zwitterion (CHEBI:233333) |
| Synonym | Source |
|---|---|
| O-(4-hydroxyphenyl)-L-tyrosine | SUBMITTER |
| UniProt Name | Source |
|---|---|
| L-thyronine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-11428 | MetaCyc |