EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2S |
| Net Charge | 0 |
| Average Mass | 200.266 |
| Monoisotopic Mass | 200.04082 |
| SMILES | N=c1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C11H8N2S/c12-11-13-10-8-4-2-1-3-7(8)5-6-9(10)14-11/h1-6H,(H2,12,13) |
| InChIKey | FECQXVPRUCCUIL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SKA-31 (CHEBI:233330) has role antihypertensive agent (CHEBI:35674) |
| SKA-31 (CHEBI:233330) has role potassium channel modulator (CHEBI:50510) |
| SKA-31 (CHEBI:233330) is a naphthothiazole (CHEBI:48903) |
| IUPAC Name |
|---|
| benzo[e][1,3]benzothiazol-2-amine |
| Synonyms | Source |
|---|---|
| naphtho[1,2-d]thiazol-2-amine | SUBMITTER |
| 2-aminonaphthiazole | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0255450 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:40172-65-4 | SUBMITTER |
| Citations |
|---|