EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233329 - dimpropyridaz
| Formula | C16H23N5O |
| Net Charge | 0 |
| Average Mass | 301.394 |
| Monoisotopic Mass | 301.19026 |
| SMILES | CCN(C(=O)c1cnn(C(C)C(C)C)c1C)c1ccnnc1 |
| InChI | InChI=1S/C16H23N5O/c1-6-20(14-7-8-17-18-9-14)16(22)15-10-19-21(13(15)5)12(4)11(2)3/h7-12H,6H2,1-5H3 |
| InChIKey | NQPGZXOPMRKAGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimpropyridaz (CHEBI:233329) has role insecticide (CHEBI:24852) |
| dimpropyridaz (CHEBI:233329) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-ethyl-5-methyl-1-(3-methylbutan-2-yl)-N-pyridazin-4-ylpyrazole-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| CAS:1403615-77-9 | SUBMITTER |
| Citations |
|---|