EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3O5S |
| Net Charge | 0 |
| Average Mass | 403.460 |
| Monoisotopic Mass | 403.12019 |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H21N3O5S/c23-19(20-16-8-6-9-17(14-16)22(24)25)15-7-5-10-18(13-15)28(26,27)21-11-3-1-2-4-12-21/h5-10,13-14H,1-4,11-12H2,(H,20,23) |
| InChIKey | HAYBKCHPEBZNGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor An EC 2.3.* (acyltransferase) inhibitor that inhibits the action of any acyltransferase transferring groups other than amino-acyl groups (EC 2.3.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AK-1 (CHEBI:233328) has role EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor (CHEBI:76878) |
| AK-1 (CHEBI:233328) is a C-nitro compound (CHEBI:35716) |
| AK-1 (CHEBI:233328) is a azepanes (CHEBI:46986) |
| AK-1 (CHEBI:233328) is a benzamides (CHEBI:22702) |
| AK-1 (CHEBI:233328) is a benzenes (CHEBI:22712) |
| AK-1 (CHEBI:233328) is a secondary carboxamide (CHEBI:140325) |
| AK-1 (CHEBI:233328) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 3-(azepan-1-ylsulfonyl)-N-(3-nitrophenyl)benzamide |
| Citations |
|---|