EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23F3N8O |
| Net Charge | 0 |
| Average Mass | 472.475 |
| Monoisotopic Mass | 472.19469 |
| SMILES | CC1(N)CCN(c2cccnc2NC(=O)c2nc(-c3ncccc3C(F)(F)F)cnc2N)CC1 |
| InChI | InChI=1S/C22H23F3N8O/c1-21(27)6-10-33(11-7-21)15-5-3-9-29-19(15)32-20(34)17-18(26)30-12-14(31-17)16-13(22(23,24)25)4-2-8-28-16/h2-5,8-9,12H,6-7,10-11,27H2,1H3,(H2,26,30)(H,29,32,34) |
| InChIKey | XXJXHXJWQSCNPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Darovasertib (CHEBI:233324) has role antineoplastic agent (CHEBI:35610) |
| Darovasertib (CHEBI:233324) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| darovasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1874276-76-2 | SUBMITTER |
| 3-amino-N-[3-(4-amino-4-methylpiperidin-1-yl)pyridin-2-yl]-6-[3-(trifluoromethyl)pyridin-2-yl]pyrazine-2-carboxamide | SUBMITTER |
| IDE-196 | ChEMBL |
| IDE196 | SUBMITTER |
| LXS-196 | ChEMBL |
| LXS196 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1874276-76-2 | SUBMITTER |
| Citations |
|---|