EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N6O6S2 |
| Net Charge | 0 |
| Average Mass | 562.674 |
| Monoisotopic Mass | 562.16682 |
| SMILES | COC[C@H](NC(=O)c1ccn(S(C)(=O)=O)c1)C(=O)Nc1nc(-c2cccc(N3C[C@@H](C)O[C@@H](C)C3)n2)cs1 |
| InChI | InChI=1S/C24H30N6O6S2/c1-15-10-29(11-16(2)36-15)21-7-5-6-18(25-21)20-14-37-24(27-20)28-23(32)19(13-35-3)26-22(31)17-8-9-30(12-17)38(4,33)34/h5-9,12,14-16,19H,10-11,13H2,1-4H3,(H,26,31)(H,27,28,32)/t15-,16+,19-/m0/s1 |
| InChIKey | JBLQNFBXKOAIHG-FCEWJHQRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FHD-286 (CHEBI:233318) has role antineoplastic agent (CHEBI:35610) |
| FHD-286 (CHEBI:233318) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 2671128-05-3 | SUBMITTER |
| camibirstat | ChEMBL |
| Camibirstat | SUBMITTER |
| Fhd-286 | ChEMBL |
| N-((S)-1-((4-(6-((2S,6R)-2,6-dimethylmorpholino)pyridin-2-yl)thiazol-2-yl)amino)-3-methoxy-1-oxopropan-2-yl)-1-(methylsulfonyl)-1H-pyrrole-3-carboxamide | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:2671128-05-3 | SUBMITTER |