EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H43N7O8 |
| Net Charge | 0 |
| Average Mass | 617.704 |
| Monoisotopic Mass | 617.31731 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCNC(=O)CCCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)O)CC1 |
| InChI | InChI=1S/C29H43N7O8/c1-2-28(42)36(21-7-4-3-5-8-21)22-11-14-35(15-12-22)16-13-30-23(37)9-6-10-24(38)31-17-25(39)32-18-26(40)33-19-27(41)34-20-29(43)44/h3-5,7-8,22H,2,6,9-20H2,1H3,(H,30,37)(H,31,38)(H,32,39)(H,33,40)(H,34,41)(H,43,44) |
| InChIKey | WBAFWCQXKNZRIF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fen-G4 (CHEBI:233300) has role hapten (CHEBI:59174) |
| fen-G4 (CHEBI:233300) is a anilide (CHEBI:13248) |
| fen-G4 (CHEBI:233300) is a glycine derivative (CHEBI:24373) |
| fen-G4 (CHEBI:233300) is a monocarboxylic acid amide (CHEBI:29347) |
| fen-G4 (CHEBI:233300) is a piperidines (CHEBI:26151) |
| fen-G4 (CHEBI:233300) is a secondary carboxamide (CHEBI:140325) |
| fen-G4 (CHEBI:233300) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-{5-oxo-5-[(2-{4-[phenyl(propanoyl)amino]piperidin-1-yl}ethyl)amino]pentanoyl}glycylglycylglycylglycine |
| Manual Xrefs | Databases |
|---|---|
| FD0 | PDBeChem |
| WO2021092446 | Patent |
| Citations |
|---|