EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](C)(C(=O)O)CCC[C@@]3(C)C1=CC[C@](C)(C=C)C2 |
| InChI | InChI=1S/C20H30O2/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(21)22/h5,9,14,16H,1,6-8,10-13H2,2-4H3,(H,21,22)/t14-,16-,18-,19-,20+/m0/s1 |
| InChIKey | TVHDZSRRHQKNEZ-MGFONVBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eleutherococcus koreanus (ncbitaxon:96667) | - | PubMed (39057081) |
| Roles Classification |
|---|
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-acanthoic acid (CHEBI:233299) has role anti-inflammatory agent (CHEBI:67079) |
| (-)-acanthoic acid (CHEBI:233299) is a organic molecular entity (CHEBI:50860) |
| Registry Numbers | Sources |
|---|---|
| CAS:119290-87-8 | SUBMITTER |
| Citations |
|---|