EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233293 - juvenate
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | [H]/C(CC/C(C)=C(\[H])C(=O)OC)=C(/C)CCC1OC1(C)C |
| InChI | InChI=1S/C16H26O3/c1-12(9-10-14-16(3,4)19-14)7-6-8-13(2)11-15(17)18-5/h7,11,14H,6,8-10H2,1-5H3/b12-7+,13-11+ |
| InChIKey | QVJMXSGZTCGLHZ-ZPLWXOMKSA-N |
| Roles Classification |
|---|
| Biological Roles: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenate (CHEBI:233293) has role hormone (CHEBI:24621) |
| juvenate (CHEBI:233293) is a juvenile hormone (CHEBI:24943) |
| IUPAC Name |
|---|
| methyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate |
| Synonym | Source |
|---|---|
| racemic juvenile hormone III | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:24198-95-6 | SUBMITTER |
| Citations |
|---|