EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H35Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 552.546 |
| Monoisotopic Mass | 551.21063 |
| SMILES | [H][C@@](CCN1CCC(NC(C)=O)(c2ccccc2)CC1)(CN(C)C(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C31H35Cl2N3O2/c1-23(37)34-31(27-11-7-4-8-12-27)16-19-36(20-17-31)18-15-26(25-13-14-28(32)29(33)21-25)22-35(2)30(38)24-9-5-3-6-10-24/h3-14,21,26H,15-20,22H2,1-2H3,(H,34,37)/t26-/m1/s1 |
| InChIKey | PGKXDIMONUAMFR-AREMUKBSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antagonist Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saredutant (CHEBI:233291) has role antagonist (CHEBI:48706) |
| saredutant (CHEBI:233291) is a acetamides (CHEBI:22160) |
| saredutant (CHEBI:233291) is a benzamides (CHEBI:22702) |
| saredutant (CHEBI:233291) is a dichlorobenzene (CHEBI:23697) |
| saredutant (CHEBI:233291) is a piperidines (CHEBI:26151) |
| saredutant (CHEBI:233291) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-[(2S)-4-(4-acetamido-4-phenylpiperidin-1-yl)-2-(3,4-dichlorophenyl)butyl]-N-methylbenzamide |
| Synonym | Source |
|---|---|
| SR 48968 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB06660 | DrugBank |
| Saredutant | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:142001-63-6 | SUBMITTER |
| Citations |
|---|