EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H48N6O10 |
| Net Charge | 0 |
| Average Mass | 772.856 |
| Monoisotopic Mass | 772.34319 |
| SMILES | COc1ccc(CC2/C(O)=N\C(C)C(=O)N(C)C3C(=O)N(C)C(Cc4ccc(O)c(c4)Oc4ccc(cc4)C3O)/C(O)=N\C(C)/C(O)=N\C(C)C(=O)N2C)cc1 |
| InChI | InChI=1S/C40H48N6O10/c1-21-35(49)42-22(2)38(52)44(4)29(18-24-8-13-27(55-7)14-9-24)37(51)43-23(3)39(53)46(6)33-34(48)26-11-15-28(16-12-26)56-32-20-25(10-17-31(32)47)19-30(36(50)41-21)45(5)40(33)54/h8-17,20-23,29-30,33-34,47-48H,18-19H2,1-7H3,(H,41,50)(H,42,49)(H,43,51) |
| InChIKey | TWOWSRSKGJSZHZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bouvardia ternifolia (ncbitaxon:29783) | - | DOI ( doi:10.1021/ja00098a015) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bouvardin (CHEBI:233285) has role antineoplastic agent (CHEBI:35610) |
| bouvardin (CHEBI:233285) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 17,24-dihydroxy-10-[(4-methoxyphenyl)methyl]-4,7,9,13,15,29-hexamethyl-22-oxa-3,6,9,12,15,29-hexazatetracyclo[14.12.2.218,21.123,27]tritriaconta-18,20,23,25,27(31),32-hexaene-2,5,8,11,14,30-hexone |
| Synonym | Source |
|---|---|
| NSC 259968 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/Bouvardin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:64755-14-2 | SUBMITTER |
| Citations |
|---|