EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O2 |
| Net Charge | 0 |
| Average Mass | 240.262 |
| Monoisotopic Mass | 240.08988 |
| SMILES | N=C(O)N(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2/c15-14(18)16(12-9-5-2-6-10-12)13(17)11-7-3-1-4-8-11/h1-10H,(H2,15,18) |
| InChIKey | XYFMGGWVGACNEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoylphenylurea (CHEBI:233279) has role insecticide (CHEBI:24852) |
| benzoylphenylurea (CHEBI:233279) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-carbamoyl-N-phenylbenzamide |
| Manual Xrefs | Databases |
|---|---|
| HMDB0249056 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1195179-46-4 | SUBMITTER |
| Citations |
|---|