EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7BrO |
| Net Charge | 0 |
| Average Mass | 211.058 |
| Monoisotopic Mass | 209.96803 |
| SMILES | [H]/C(=C(/Br)C=O)c1ccccc1 |
| InChI | InChI=1S/C9H7BrO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-7H/b9-6- |
| InChIKey | WQRWNOKNRHCLHV-TWGQIWQCSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial drug A drug used to treat or prevent microbial infections. |
| Application: | antimicrobial drug A drug used to treat or prevent microbial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-bromocinnamaldehyde (CHEBI:233277) has role antimicrobial drug (CHEBI:36043) |
| α-bromocinnamaldehyde (CHEBI:233277) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (Z)-2-bromo-3-phenylprop-2-enal |
| Synonyms | Source |
|---|---|
| alpha-bromocinnamaldehyde | SUBMITTER |
| 2-bromo-3-phenylacrylaldehyde | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:5443-49-2 | SUBMITTER |
| Citations |
|---|