EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10FNO2S.HCl |
| Net Charge | 0 |
| Average Mass | 239.699 |
| Monoisotopic Mass | 239.01831 |
| SMILES | Cl.NCCc1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C8H10FNO2S.ClH/c9-13(11,12)8-3-1-7(2-4-8)5-6-10;/h1-4H,5-6,10H2;1H |
| InChIKey | WRDABNWSWOHGMS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-aminoethyl)benzenesulfonyl fluoride hydrochloride (CHEBI:233276) has role serine protease inhibitor (CHEBI:64926) |
| 4-(2-aminoethyl)benzenesulfonyl fluoride hydrochloride (CHEBI:233276) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
| Synonyms | Source |
|---|---|
| AEBSF | SUBMITTER |
| Pefabloc | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/AEBSF | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:30827-99-7 | SUBMITTER |
| Citations |
|---|