EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N.HCl |
| Net Charge | 0 |
| Average Mass | 209.720 |
| Monoisotopic Mass | 209.09713 |
| SMILES | CN1CC=C(c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C12H15N.ClH/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-7H,8-10H2,1H3;1H |
| InChIKey | KOWJANGMTAZWDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MPTP hydrochloride (CHEBI:233275) has role neurotoxin (CHEBI:50910) |
| MPTP hydrochloride (CHEBI:233275) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-methyl-4-phenyl-3,6-dihydro-2H-pyridine;hydrochloride |
| Registry Numbers | Sources |
|---|---|
| CAS:23007-85-4 | SUBMITTER |
| Citations |
|---|