EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NS |
| Net Charge | 0 |
| Average Mass | 129.228 |
| Monoisotopic Mass | 129.06122 |
| SMILES | CCC1CSC(C)=N1 |
| InChI | InChI=1S/C6H11NS/c1-3-6-4-8-5(2)7-6/h6H,3-4H2,1-2H3 |
| InChIKey | LENVRVUQOXYSDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | TRP channel modulator An agent that modulates the passage of cations through the transient receptor potential (TRP) channels. |
| Application: | insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-4-ethylthiazoline (CHEBI:233272) has role insect repellent (CHEBI:71692) |
| 2-methyl-4-ethylthiazoline (CHEBI:233272) has role TRP channel modulator (CHEBI:142783) |
| 2-methyl-4-ethylthiazoline (CHEBI:233272) is a 2-thiazolines (CHEBI:188452) |
| IUPAC Name |
|---|
| 4-ethyl-2-methyl-4,5-dihydro-1,3-thiazole |
| Synonyms | Source |
|---|---|
| 2-methyl-4-ethyl-2-thiazoline | ChEBI |
| 4-ethyl-2-methyl-2-thiazoline | ChEBI |
| 4-ethyl-2-methyl-4,5-dihydrothiazole | ChEBI |
| 4-ethyl-2-methylthiazoline | ChEBI |
| 4-ethyl-4,5-dihydro-2-methylthiazole | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:970286 | Reaxys |
| CAS:4293-61-2 | NIST Chemistry WebBook |
| Citations |
|---|