EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34O14 |
| Net Charge | 0 |
| Average Mass | 654.621 |
| Monoisotopic Mass | 654.19486 |
| SMILES | COCC1Oc2cc(C3OCC4(O)C(Oc5c(OC)cc6c(c5OC)OCO6)OCC34)c(OC)cc2OC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H34O14/c1-35-12-26-27(16-5-6-19-21(7-16)42-14-41-19)46-23-9-20(36-2)17(8-22(23)45-26)28-18-11-39-32(33(18,34)13-40-28)47-30-24(37-3)10-25-29(31(30)38-4)44-15-43-25/h5-10,18,26-28,32,34H,11-15H2,1-4H3 |
| InChIKey | SVQIUEXUTJVJTM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phryma leptostachya (ncbitaxon:41401) | - | PubMed (36752392) |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haedoxan A (CHEBI:233271) has role insecticide (CHEBI:24852) |
| haedoxan A (CHEBI:233271) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 6-[3-(1,3-benzodioxol-5-yl)-6-methoxy-2-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]-3-[(4,6-dimethoxy-1,3-benzodioxol-5-yl)oxy]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
| Citations |
|---|