EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H2Cl3F5O |
| Net Charge | 0 |
| Average Mass | 315.452 |
| Monoisotopic Mass | 313.90914 |
| SMILES | OC(c1c(F)c(F)c(F)c(F)c1F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H2Cl3F5O/c9-8(10,11)7(17)1-2(12)4(14)6(16)5(15)3(1)13/h7,17H |
| InChIKey | PMCBIVRSJJRRIJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2,2-trichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanol (CHEBI:233267) has role insecticide (CHEBI:24852) |
| 2,2,2-trichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanol (CHEBI:233267) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2,2,2-trichloro-1-(2,3,4,5,6-pentafluorophenyl)ethanol |
| Citations |
|---|