EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12FIN2O3 |
| Net Charge | 0 |
| Average Mass | 414.174 |
| Monoisotopic Mass | 413.98767 |
| SMILES | [H]/C(=N/N=C(\O)c1cccc(F)c1)c1cc(I)c(O)c(OC)c1 |
| InChI | InChI=1S/C15H12FIN2O3/c1-22-13-6-9(5-12(17)14(13)20)8-18-19-15(21)10-3-2-4-11(16)7-10/h2-8,20H,1H3,(H,19,21)/b18-8- |
| InChIKey | UIADDCURKKFTFW-LSCVHKIXSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endosidin 2 (CHEBI:233265) has role inhibitor (CHEBI:35222) |
| endosidin 2 (CHEBI:233265) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-fluoro-N-[(Z)-(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]benzamide |
| Citations |
|---|