EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14FNO |
| Net Charge | 0 |
| Average Mass | 207.248 |
| Monoisotopic Mass | 207.10594 |
| SMILES | [H]/C(=C(C)\C(CC)=N/O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FNO/c1-3-12(14-15)9(2)8-10-4-6-11(13)7-5-10/h4-8,15H,3H2,1-2H3/b9-8+,14-12- |
| InChIKey | HKROEBDHHKMNBZ-BYKJOZEVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. antiviral agent A substance that destroys or inhibits replication of viruses. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A-967079 (CHEBI:233256) has role anti-inflammatory agent (CHEBI:67079) |
| A-967079 (CHEBI:233256) has role antiviral agent (CHEBI:22587) |
| A-967079 (CHEBI:233256) has role non-narcotic analgesic (CHEBI:35481) |
| A-967079 (CHEBI:233256) has role TRP channel blocker (CHEBI:139361) |
| A-967079 (CHEBI:233256) is a monofluorobenzenes (CHEBI:83575) |
| IUPAC Name |
|---|
| (NZ)-N-[(E)-1-(4-fluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine |
| Synonyms | Source |
|---|---|
| A 967079 | ChEBI |
| A967079 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| A-967079 | Wikipedia |
| Citations |
|---|