EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22O9/c1-24-13-7-10(8-14(25-2)17(13)26-3)12-9-11(22)15-16(23)19(27-4)21(29-6)20(28-5)18(15)30-12/h7-9,23H,1-6H3 |
| InChIKey | MQBFFYQCZCKSBX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gardenia gummifera (ncbitaxon:1357586) | - | PubMed (32181517) |
| Roles Classification |
|---|
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gardenin A (CHEBI:233255) has role anticonvulsant (CHEBI:35623) |
| gardenin A (CHEBI:233255) has role anxiolytic drug (CHEBI:35474) |
| gardenin A (CHEBI:233255) is a flavonoid (CHEBI:47916) |
| IUPAC Name |
|---|
| 5-hydroxy-6,7,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| LMPK12111493 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:21187-73-5 | SUBMITTER |