EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO3 |
| Net Charge | +1 |
| Average Mass | 288.367 |
| Monoisotopic Mass | 288.15942 |
| SMILES | [H][C@]1(C(C)C)CC2=C(OC)c3cccc(OC)c3N(C)C2=[O+]1 |
| InChI | InChI=1S/C17H22NO3/c1-10(2)14-9-12-16(20-5)11-7-6-8-13(19-4)15(11)18(3)17(12)21-14/h6-8,10,14H,9H2,1-5H3/q+1/t14-/m1/s1 |
| InChIKey | GUIBZZYABLMRRD-CQSZACIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | PubMed (30200502) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lunasine (CHEBI:233245) has role antineoplastic agent (CHEBI:35610) |
| lunasine (CHEBI:233245) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-4,8-dimethoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-9-ium |
| Synonym | Source |
|---|---|
| lunasin | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB16223 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:6901-22-0 | SUBMITTER |
| Citations |
|---|