EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C21H22N2O2.H2O4S |
| Net Charge | 0 |
| Average Mass | 766.917 |
| Monoisotopic Mass | 766.30364 |
| SMILES | O=S(=O)(O)O.[H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H].[H][C@@]12N3C(=O)C[C@]4([H])OCC=C5CN6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/2C21H22N2O2.H2O4S/c2*24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21;1-5(2,3)4/h2*1-5,13,16-17,19-20H,6-11H2;(H2,1,2,3,4)/t2*13-,16-,17-,19-,20-,21+;/m00./s1 |
| InChIKey | GOOCRIHPADOQAS-ZNUXJMJHSA-N |
| Roles Classification |
|---|
| Biological Role: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnine sulfate (CHEBI:233239) has functional parent strychnine (CHEBI:28973) |
| strychnine sulfate (CHEBI:233239) has role poison (CHEBI:64909) |
| strychnine sulfate (CHEBI:233239) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (4aR,5aS,8aR,13aS,15aS,15bR)-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one;sulfuric acid |
| Synonym | Source |
|---|---|
| strychnine hemisulfate salt | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:60-41-3 | SUBMITTER |
| Citations |
|---|