EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O |
| Net Charge | 0 |
| Average Mass | 182.307 |
| Monoisotopic Mass | 182.16707 |
| SMILES | CCC1(O)C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C12H22O/c1-5-12(13)10(2,3)9-6-7-11(12,4)8-9/h9,13H,5-8H2,1-4H3 |
| InChIKey | KIPCKEJKGCXRGA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eremophila deserti (ncbitaxon:2652521) | leaf (BTO:0000713) | PubMed (33923613) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylfenchol (CHEBI:233234) has role fragrance (CHEBI:48318) |
| 2-ethylfenchol (CHEBI:233234) has role plant metabolite (CHEBI:76924) |
| 2-ethylfenchol (CHEBI:233234) is a carbobicyclic compound (CHEBI:36785) |
| 2-ethylfenchol (CHEBI:233234) is a fenchane monoterpenoid (CHEBI:36739) |
| 2-ethylfenchol (CHEBI:233234) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2-ethyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| Synonyms | Source |
|---|---|
| FEMA 3491 | ChEBI |
| 2-ethyl fenchol | ChEBI |
| 2-ethyl-1,3,3-trimethyl-2-norbornanol | ChEBI |
| 2-ethyl-1,3,3-trimethylnorbornan-2-ol | ChEBI |
| 6-ethyl-1,5,5-trimethylbicyclo[2.2.1]heptan-6-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3044187 | Reaxys |
| CAS:18368-91-7 | ChEBI |
| Citations |
|---|