EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9ClN4 |
| Net Charge | 0 |
| Average Mass | 196.641 |
| Monoisotopic Mass | 196.05157 |
| SMILES | [H]/C(=N\NC(=N)N)c1ccccc1Cl |
| InChI | InChI=1S/C8H9ClN4/c9-7-4-2-1-3-6(7)5-12-13-8(10)11/h1-5H,(H4,10,11,13)/b12-5+ |
| InChIKey | PDWJALXSRRSUHR-LFYBBSHMSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icerguastat (CHEBI:233229) has role inhibitor (CHEBI:35222) |
| icerguastat (CHEBI:233229) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[(E)-(2-chlorophenyl)methylideneamino]guanidine |
| Synonyms | Source |
|---|---|
| IFB-088 | SUBMITTER |
| selective inhibitor of a holophosphatase 1 | SUBMITTER |
| Sephin1 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB16932 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:951441-04-6 | SUBMITTER |
| Citations |
|---|