EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N2S.I |
| Net Charge | 0 |
| Average Mass | 488.438 |
| Monoisotopic Mass | 488.07832 |
| SMILES | CCN1/C(=C\C=C\C2=[N+](C)c3ccccc3C2(C)C)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C23H25N2S.HI/c1-5-25-19-13-8-9-14-20(19)26-22(25)16-10-15-21-23(2,3)17-11-6-7-12-18(17)24(21)4;/h6-16H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | TWBRXRGFFUATNI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor An EC 2.3.* (acyltransferase) inhibitor that inhibits the action of any acyltransferase transferring groups other than amino-acyl groups (EC 2.3.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AC-93253 iodide (CHEBI:233224) has role EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor (CHEBI:76878) |
| AC-93253 iodide (CHEBI:233224) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium;iodide |
| Synonym | Source |
|---|---|
| Benzothiazolium, 2-[3-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-1-propen-1-yl]-3-ethyl-, iodide | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:108527-83-9 | SUBMITTER |