EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O5S |
| Net Charge | 0 |
| Average Mass | 276.269 |
| Monoisotopic Mass | 276.00924 |
| SMILES | O=S1(=O)Oc2cc3c(c(c2O)O1)Cc1ccccc1-3 |
| InChI | InChI=1S/C13H8O5S/c14-12-11-6-9-8-4-2-1-3-7(8)5-10(9)13(12)18-19(15,16)17-11/h1-4,6,14H,5H2 |
| InChIKey | OBPJHWVIUJOPQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyfluorene sulfate (CHEBI:233212) is a fluorenes (CHEBI:24059) |