EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H24O15 |
| Net Charge | 0 |
| Average Mass | 636.518 |
| Monoisotopic Mass | 636.11152 |
| SMILES | [H][C@@]1(Oc2cccc3c(=O)c4c(O)c5c(c(O)c4oc23)CCc2cc(CC(C)=O)c(C(=O)O)c(O)c2-5)OC(C(=O)O)=C(O)[C@]([H])(O)[C@@]1([H])O |
| InChI | InChI=1S/C31H24O15/c1-9(32)7-11-8-10-5-6-12-17(15(10)21(35)16(11)29(40)41)22(36)18-19(33)13-3-2-4-14(26(13)45-27(18)20(12)34)44-31-25(39)23(37)24(38)28(46-31)30(42)43/h2-4,8,23,25,31,34-39H,5-7H2,1H3,(H,40,41)(H,42,43)/t23-,25+,31+/m0/s1 |
| InChIKey | QVDLFPGGRVEIPG-XXYDJGGASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces chrestomyceticus (ncbitaxon:68185) | - | PubMed (36226410) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrexanthomycin C (CHEBI:233196) has role radical scavenger (CHEBI:48578) |
| chrexanthomycin C (CHEBI:233196) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 9-[[(2R,3R,4R)-6-carboxy-3,4,5-trihydroxy-3,4-dihydro-2H-pyran-2-yl]oxy]-1,7,14-trihydroxy-13-oxo-3-(2-oxopropyl)-5,6-dihydronaphtho[1,2-b]xanthene-2-carboxylic acid |
| Citations |
|---|