EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233194 - chrexanthomycin A
| Formula | C31H24O14 |
| Net Charge | 0 |
| Average Mass | 620.519 |
| Monoisotopic Mass | 620.11661 |
| SMILES | [H][C@@]1(Oc2cccc3c(=O)c4c(O)c5c(c(O)c4oc23)CCc2cc(CC(C)=O)c(C(=O)O)c(O)c2-5)OC(C(=O)O)=C[C@]([H])(O)[C@@]1([H])O |
| InChI | InChI=1S/C31H24O14/c1-10(32)7-12-8-11-5-6-13-20(18(11)25(37)19(12)30(41)42)26(38)21-22(34)14-3-2-4-16(27(14)45-28(21)23(13)35)43-31-24(36)15(33)9-17(44-31)29(39)40/h2-4,8-9,15,24,31,33,35-38H,5-7H2,1H3,(H,39,40)(H,41,42)/t15-,24+,31+/m0/s1 |
| InChIKey | ORHBKSSEQWAIQC-CZPJXKIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces chrestomyceticus (ncbitaxon:68185) | - | PubMed (36226410) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrexanthomycin A (CHEBI:233194) has role radical scavenger (CHEBI:48578) |
| chrexanthomycin A (CHEBI:233194) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 9-[[(2R,3R,4S)-6-carboxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-2-yl]oxy]-1,7,14-trihydroxy-13-oxo-3-(2-oxopropyl)-5,6-dihydronaphtho[1,2-b]xanthene-2-carboxylic acid |
| Citations |
|---|