EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H45NO9S2 |
| Net Charge | 0 |
| Average Mass | 579.778 |
| Monoisotopic Mass | 579.25357 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@]([H])(C)CCC(=O)NCCS(=O)(=O)O)[C@@]1(C)CC[C@@H](OS(=O)(=O)O)C2 |
| InChI | InChI=1S/C26H45NO9S2/c1-16(4-9-24(29)27-12-13-37(30,31)32)20-7-8-21-19-6-5-17-14-18(36-38(33,34)35)10-11-25(17,2)22(19)15-23(28)26(20,21)3/h16-23,28H,4-15H2,1-3H3,(H,27,29)(H,30,31,32)(H,33,34,35)/t16-,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1 |
| InChIKey | UCVGCHGIKFWAGH-VAYUFCLWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taurodeoxycholic acid 3-sulfate (CHEBI:233167) is a bile acid (CHEBI:3098) |
| Incoming Relation(s) |
| 3α-sulfotaurodeoxycholate(2−) (CHEBI:195625) is conjugate base of taurodeoxycholic acid 3-sulfate (CHEBI:233167) |