EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N5O2 |
| Net Charge | 0 |
| Average Mass | 233.231 |
| Monoisotopic Mass | 233.09127 |
| SMILES | CC(N)(C(=O)O)c1ccc(-c2nnnn2)cc1 |
| InChI | InChI=1S/C10H11N5O2/c1-10(11,9(16)17)7-4-2-6(3-5-7)8-12-14-15-13-8/h2-5H,11H2,1H3,(H,16,17)(H,12,13,14,15) |
| InChIKey | OZBFBAYESADVDX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (RS)-α-methyl-4-tetrazolylphenylglycine (CHEBI:233163) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| (RS)-α-methyl-4-tetrazolylphenylglycine (CHEBI:233163) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-amino-2-[4-(2H-tetrazol-5-yl)phenyl]propanoic acid |
| Citations |
|---|