EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl3F2 |
| Net Charge | 0 |
| Average Mass | 321.581 |
| Monoisotopic Mass | 319.97379 |
| SMILES | Fc1ccc(C(c2ccc(F)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3F2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13H |
| InChIKey | CLSXNIPAOWPLFR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difluorodiphenyltrichloroethane (CHEBI:233159) has role insecticide (CHEBI:24852) |
| difluorodiphenyltrichloroethane (CHEBI:233159) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-fluoro-4-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene |
| Synonyms | Source |
|---|---|
| DFDT | SUBMITTER |
| fluorogesarol | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/DFDT | Wikipedia |
| Citations |
|---|