EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N3O2 |
| Net Charge | 0 |
| Average Mass | 373.456 |
| Monoisotopic Mass | 373.17903 |
| SMILES | O=C(c1cccnc1-c1ccncc1)N1CCC(O)(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H23N3O2/c27-22(20-7-4-12-25-21(20)19-8-13-24-14-9-19)26-15-10-23(28,11-16-26)17-18-5-2-1-3-6-18/h1-9,12-14,28H,10-11,15-17H2 |
| InChIKey | XKUZMIUSBMCVPP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soticlestat (CHEBI:233158) has role analgesic (CHEBI:35480) |
| soticlestat (CHEBI:233158) has role anticonvulsant (CHEBI:35623) |
| soticlestat (CHEBI:233158) is a benzenes (CHEBI:22712) |
| soticlestat (CHEBI:233158) is a bipyridines (CHEBI:50511) |
| soticlestat (CHEBI:233158) is a hydroxypiperidine (CHEBI:48590) |
| soticlestat (CHEBI:233158) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (4-benzyl-4-hydroxypiperidin-1-yl)([2,4'-bipyridin]-3-yl)methanone |
| INNs | Source |
|---|---|
| soticlestat | WHO MedNet |
| soticlestat | WHO MedNet |
| soticlestat | WHO MedNet |
| soticlestatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| OV 935 | ChEBI |
| OV-935 | DrugBank |
| OV935 | DrugBank |
| TAK 935 | ChEBI |
| TAK-935 | DrugBank |
| TAK935 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D11590 | KEGG DRUG |
| DB16987 | DrugBank |
| Soticlestat | Wikipedia |
| Citations |
|---|